<html><head></head><body style="word-wrap: break-word; -webkit-nbsp-mode: space; -webkit-line-break: after-white-space; ">The Python would be:<div><br></div><div>from chimera import dialogs</div><div>from StructureDiagram.gui import StructureDiagramDialog</div><div>dlg = dialogs.display(<a href="http://StructureDiagramDialog.name">StructureDiagramDialog.name</a>)</div><div>dlg.updateImageFromSmiles("C1[C@H]2[C@@H]([C@@H](S1)CCCCC(=O)O)NC(=O)N2")</div><div><br></div><div>Put the above in a file with a ".py" suffix and just follow the instructions Elaine gave.</div><div><br></div><div>--Eric</div><div><br></div><div><div><span class="Apple-style-span" style="border-collapse: separate; -webkit-border-horizontal-spacing: 0px; -webkit-border-vertical-spacing: 0px; color: rgb(0, 0, 0); font-family: Helvetica; font-size: 16px; font-style: normal; font-variant: normal; font-weight: normal; letter-spacing: normal; line-height: normal; -webkit-text-decorations-in-effect: none; text-indent: 0px; -webkit-text-size-adjust: auto; text-transform: none; orphans: 2; white-space: normal; widows: 2; word-spacing: 0px; "><div style="margin-top: 0px; margin-right: 0px; margin-bottom: 0px; margin-left: 0px; "><font face="Helvetica" size="5" style="font: normal normal normal 16px/normal Helvetica; ">&nbsp; &nbsp; &nbsp; &nbsp; &nbsp; &nbsp; &nbsp; &nbsp; &nbsp; &nbsp; &nbsp; &nbsp;&nbsp;Eric Pettersen</font></div><div style="margin-top: 0px; margin-right: 0px; margin-bottom: 0px; margin-left: 0px; "><font face="Helvetica" size="5" style="font: normal normal normal 16px/normal Helvetica; ">&nbsp; &nbsp; &nbsp; &nbsp; &nbsp; &nbsp; &nbsp; &nbsp; &nbsp; &nbsp; &nbsp; &nbsp;&nbsp;UCSF Computer Graphics Lab</font></div><div style="margin-top: 0px; margin-right: 0px; margin-bottom: 0px; margin-left: 0px; "><font face="Helvetica" size="5" style="font: normal normal normal 16px/normal Helvetica; ">&nbsp; &nbsp;&nbsp; &nbsp;&nbsp; &nbsp;&nbsp; &nbsp;&nbsp; &nbsp;&nbsp; &nbsp;&nbsp; &nbsp;&nbsp; &nbsp;<a href="http://www.cgl.ucsf.edu">http://www.cgl.ucsf.edu</a></font></div><br class="Apple-interchange-newline"></span></div><div><div>On Feb 13, 2013, at 10:14 AM, Elaine Meng wrote:</div><br class="Apple-interchange-newline"><blockquote type="cite"><div>Hi Noel,<br>Sorry, there is no command to show structure diagrams. &nbsp;If the demo must do this, the only possibility (that I know of) is to do it in a python script. &nbsp;In the demo, you can use the "open" command to open and execute the *.py file (the script, which would be one of your demo data files).<br><br>For example, in the "Hormone-Receptor Complex Demo" that comes with Chimera, there is an "undo" command in panel 6 that opens a python script. &nbsp;The script simply closes the sequence alignment window.<br><br>I don't know python, so someone else would need to help with the script itself.<br><br>Best,<br>Elaine<br>-----<br>Elaine C. Meng, Ph.D. &nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;<br>UCSF Computer Graphics Lab (Chimera team) and Babbitt Lab<br>Department of Pharmaceutical Chemistry<br>University of California, San Francisco<br><br>On Feb 12, 2013, at 5:02 PM, Noel Pace wrote:<br><br><blockquote type="cite">Dear Elaine, <br></blockquote><blockquote type="cite"><br></blockquote><blockquote type="cite">Thank you for your constant help...I am getting more proficient with the program language however I have encountered a difficulty and cannot resolve it using the manual.<br></blockquote><blockquote type="cite"><br></blockquote><blockquote type="cite">I require the command to run the UTILITY: Structure diagram, then make it load SMILES code: C1[C@H]2[C@@H]([C@@H](S1)CCCCC(=O)O)NC(=O)N2<br></blockquote><blockquote type="cite"><br></blockquote><blockquote type="cite">How can I make this possible please?<br></blockquote><blockquote type="cite"><br></blockquote><blockquote type="cite">Thanks again,<br></blockquote><blockquote type="cite">Noel<br></blockquote><br><br>_______________________________________________<br>Chimera-users mailing list<br><a href="mailto:Chimera-users@cgl.ucsf.edu">Chimera-users@cgl.ucsf.edu</a><br>http://plato.cgl.ucsf.edu/mailman/listinfo/chimera-users<br></div></blockquote></div><br></div><br><br></body></html>